| Name | 5-Chlorovaleric acid |
| Synonyms | CVA ITGB5 214-279-3 5-CHLOROPENTANOIC RARECHEM AL BO 0182 5-Chlorovaleric acid 5-chloropentanoic acid 5-CHLOROPENTANOIC ACID 5-CHLORO-N-VALERIC ACID pentanoic acid, 5-chloro- Anti-Integrin β5, C-Terminal antibody produced in rabbit |
| CAS | 1119-46-6 |
| EINECS | 214-279-3 |
| InChI | InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
| InChIKey | YSXDKDWNIPOSMF-UHFFFAOYSA-N |
| Molecular Formula | C5H9ClO2 |
| Molar Mass | 136.58 |
| Density | 1.170 g/mL at 20 °C (lit.) |
| Melting Point | 18 °C (lit.) |
| Boling Point | 136 °C / 14mmHg |
| Flash Point | >230°F |
| Solubility | Chloroform, DMSO, Ethyl Acetate |
| Vapor Presure | 0.0227mmHg at 25°C |
| Appearance | Oil |
| Specific Gravity | 1.17 |
| Color | Clear Colourless |
| BRN | 1745183 |
| pKa | 4?+-.0.10(Predicted) |
| PH | 2.5 (100g/l, H2O, 20℃)(as an emulsion) |
| Storage Condition | 2-8°C |
| Refractive Index | n20/D 1.454(lit.) |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | 3265 |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8 |
| HS Code | 29159080 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | for pharmaceutical intermediates |